C29H15Cl3O4 — CID 162025224
2-chloro-3-methylanthracene-9,10-dione;2,3-dichloroanthracene-9,10-dione (PubChem CID 162025224) has the molecular formula C29H15Cl3O4 and a molecular weight of 533.79 g/mol. Its IUPAC name is 2-chloro-3-methylanthracene-9,10-dione;2,3-dichloroanthracene-9,10-dione.
| Compound Name | 2-chloro-3-methylanthracene-9,10-dione;2,3-dichloroanthracene-9,10-dione |
|---|---|
| PubChem CID | 162025224 |
| Molecular Formula | C29H15Cl3O4 |
| Molecular Weight | 533.79 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | 2-chloro-3-methylanthracene-9,10-dione;2,3-dichloroanthracene-9,10-dione |
| SMILES | Cc1cc2c(cc1Cl)C(=O)c1ccccc1C2=O.O=C1c2ccccc2C(=O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C15H9ClO2.C14H6Cl2O2/c1-8-6-11-12(7-13(8)16)15(18)10-5-3-2-4-9(10)14(11)17;15-11-5-9-10(6-12(11)16)14(18)8-4-2-1-3-7(8)13(9)17/h2-7H,1H3;1-6H |
| InChIKey | YVGZLZGRICJDIU-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.79 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|