C9H12O3 — CID 154533883
3,4-dimethoxycyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 154533883) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 3,4-dimethoxycyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 3,4-dimethoxycyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 154533883 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3,4-dimethoxycyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | COC1=C(OC)CCC(C=O)=C1 |
| InChI | InChI=1S/C9H12O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | NCYIUYHRAPMVOF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|