C8H8N2O2 — CID 154545663
3,4-diisocyanatocyclohexene (PubChem CID 154545663) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 3,4-diisocyanatocyclohexene.
| Compound Name | 3,4-diisocyanatocyclohexene |
|---|---|
| PubChem CID | 154545663 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 3,4-diisocyanatocyclohexene |
| SMILES | O=C=NC1C=CCCC1N=C=O |
| InChI | InChI=1S/C8H8N2O2/c11-5-9-7-3-1-2-4-8(7)10-6-12/h1,3,7-8H,2,4H2 |
| InChIKey | WNVGKHPAEWGREM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|