About 3,4-diisocyanatohept-1-ene
3,4-diisocyanatohept-1-ene (PubChem CID 18755112) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 3,4-diisocyanatohept-1-ene.
Molecular Properties
| Compound Name | 3,4-diisocyanatohept-1-ene |
| PubChem CID | 18755112 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3,4-diisocyanatohept-1-ene |
| SMILES | C=CC(N=C=O)C(CCC)N=C=O |
| InChI | InChI=1S/C9H12N2O2/c1-3-5-9(11-7-13)8(4-2)10-6-12/h4,8-9H,2-3,5H2,1H3 |
| InChIKey | WVCRFYKFNDVILG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diisocyanatohept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diisocyanatohept-1-ene?
The IUPAC name of 3,4-diisocyanatohept-1-ene (CID 18755112) is 3,4-diisocyanatohept-1-ene.
What is the SMILES notation for 3,4-diisocyanatohept-1-ene?
The canonical SMILES for 3,4-diisocyanatohept-1-ene is C=CC(N=C=O)C(CCC)N=C=O.
What is the InChIKey of 3,4-diisocyanatohept-1-ene?
The InChIKey is WVCRFYKFNDVILG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-3-5-9(11-7-13)8(4-2)10-6-12/h4,8-9H,2-3,5H2,1H3.
What are the key properties of 3,4-diisocyanatohept-1-ene?
3,4-diisocyanatohept-1-ene has a molecular weight of 180.21 g/mol, XLogP of 1.38, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diisocyanatohept-1-ene is sourced from PubChem (CID 18755112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).