C8H10F3NO2 — CID 154551266
ethyl (E)-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate (PubChem CID 154551266) has the molecular formula C8H10F3NO2 and a molecular weight of 209.17 g/mol. Its IUPAC name is ethyl (E)-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate.
| Compound Name | ethyl (E)-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate |
|---|---|
| PubChem CID | 154551266 |
| Molecular Formula | C8H10F3NO2 |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | ethyl (E)-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate |
| SMILES | [H]/N=C(C(=C\C)/C(=O)OCC)\C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO2/c1-3-5(7(13)14-4-2)6(12)8(9,10)11/h3,12H,4H2,1-2H3/b5-3+,12-6- |
| InChIKey | KFYJYJHDSQEACP-HWRREHFZSA-N |
| XLogP | 2.08 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|