C8H12F2N2O2 — CID 172953135
ethyl (E)-4-[(E,3E)-4,4-difluoro-3-hydrazinylidenebut-1-enyl]-2-[(E)-1-(difluoromethyl)but-2-enehydrazonoyl]-3-methylbut-2-enoate (PubChem CID 172953135) has the molecular formula C8H12F2N2O2 and a molecular weight of 206.19 g/mol. Its IUPAC name is ethyl (E)-4-[(E,3E)-4,4-difluoro-3-hydrazinylidenebut-1-enyl]-2-[(E)-1-(difluoromethyl)but-2-enehydrazonoyl]-3-methylbut-2-enoate.
| Compound Name | ethyl (E)-4-[(E,3E)-4,4-difluoro-3-hydrazinylidenebut-1-enyl]-2-[(E)-1-(difluoromethyl)but-2-enehydrazonoyl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 172953135 |
| Molecular Formula | C8H12F2N2O2 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | ethyl (E)-4-[(E,3E)-4,4-difluoro-3-hydrazinylidenebut-1-enyl]-2-[(E)-1-(difluoromethyl)but-2-enehydrazonoyl]-3-methylbut-2-enoate |
| SMILES | C/C=C(C(=O)OCC)\C(=N/N)C(F)F |
| InChI | InChI=1S/C8H12F2N2O2/c1-3-5(8(13)14-4-2)6(12-11)7(9)10/h3,7H,4,11H2,1-2H3/b5-3+,12-6+ |
| InChIKey | KYUVEKSVQAOJIP-IBAXKFRNSA-N |
| XLogP | 1.08 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|