C11H16F2N2O2 — CID 155281097
ethyl (2E,4E)-5,5-difluoro-4-hydrazinylidene-2,6-dimethylhepta-2,6-dienoate (PubChem CID 155281097) has the molecular formula C11H16F2N2O2 and a molecular weight of 246.26 g/mol. Its IUPAC name is ethyl (2E,4E)-5,5-difluoro-4-hydrazinylidene-2,6-dimethylhepta-2,6-dienoate.
| Compound Name | ethyl (2E,4E)-5,5-difluoro-4-hydrazinylidene-2,6-dimethylhepta-2,6-dienoate |
|---|---|
| PubChem CID | 155281097 |
| Molecular Formula | C11H16F2N2O2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | ethyl (2E,4E)-5,5-difluoro-4-hydrazinylidene-2,6-dimethylhepta-2,6-dienoate |
| SMILES | C=C(C)C(F)(F)C(/C=C(\C)C(=O)OCC)=N/N |
| InChI | InChI=1S/C11H16F2N2O2/c1-5-17-10(16)8(4)6-9(15-14)11(12,13)7(2)3/h6H,2,5,14H2,1,3-4H3/b8-6+,15-9+ |
| InChIKey | GMQHKJUNWJVHDV-SKAFZBRJSA-N |
| XLogP | 2.02 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|