C10H23N3 — CID 154560398
(E)-5-N,2,6-trimethylhept-3-ene-3,4,5-triamine (PubChem CID 154560398) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is (E)-5-N,2,6-trimethylhept-3-ene-3,4,5-triamine.
| Compound Name | (E)-5-N,2,6-trimethylhept-3-ene-3,4,5-triamine |
|---|---|
| PubChem CID | 154560398 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | (E)-5-N,2,6-trimethylhept-3-ene-3,4,5-triamine |
| SMILES | CNC(/C(N)=C(\N)C(C)C)C(C)C |
| InChI | InChI=1S/C10H23N3/c1-6(2)8(11)9(12)10(13-5)7(3)4/h6-7,10,13H,11-12H2,1-5H3/b9-8+ |
| InChIKey | IBPQFAULKBBUAH-CMDGGOBGSA-N |
| XLogP | 1.02 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |