C18H26Cl2N2O — CID 154562211
3,4-dichloro-N-[2-(dimethylamino)cyclohexyl]-N-propan-2-ylbenzamide (PubChem CID 154562211) has the molecular formula C18H26Cl2N2O and a molecular weight of 357.33 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(dimethylamino)cyclohexyl]-N-propan-2-ylbenzamide.
| Compound Name | 3,4-dichloro-N-[2-(dimethylamino)cyclohexyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 154562211 |
| Molecular Formula | C18H26Cl2N2O |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 3,4-dichloro-N-[2-(dimethylamino)cyclohexyl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(C(=O)c1ccc(Cl)c(Cl)c1)C1CCCCC1N(C)C |
| InChI | InChI=1S/C18H26Cl2N2O/c1-12(2)22(17-8-6-5-7-16(17)21(3)4)18(23)13-9-10-14(19)15(20)11-13/h9-12,16-17H,5-8H2,1-4H3 |
| InChIKey | LGYQSYWASFBSHJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |