C18H24Cl2N2O2 — CID 23349811
3,4-dichloro-N-[2-(3-hydroxypyrrolidin-1-yl)cyclohexyl]-N-methylbenzamide (PubChem CID 23349811) has the molecular formula C18H24Cl2N2O2 and a molecular weight of 371.31 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(3-hydroxypyrrolidin-1-yl)cyclohexyl]-N-methylbenzamide.
| Compound Name | 3,4-dichloro-N-[2-(3-hydroxypyrrolidin-1-yl)cyclohexyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 23349811 |
| Molecular Formula | C18H24Cl2N2O2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 3,4-dichloro-N-[2-(3-hydroxypyrrolidin-1-yl)cyclohexyl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(Cl)c(Cl)c1)C1CCCCC1N1CCC(O)C1 |
| InChI | InChI=1S/C18H24Cl2N2O2/c1-21(18(24)12-6-7-14(19)15(20)10-12)16-4-2-3-5-17(16)22-9-8-13(23)11-22/h6-7,10,13,16-17,23H,2-5,8-9,11H2,1H3 |
| InChIKey | QSUXPMLDNCTXGZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |