About ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate
ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate (PubChem CID 154563768) has the molecular formula C19H24ClN3O4
and a molecular weight of 393.87 g/mol. Its IUPAC name is ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate |
| PubChem CID | 154563768 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)CC1CCCN(c2nc3ccc(Cl)cc3o2)C1 |
| InChI | InChI=1S/C19H24ClN3O4/c1-2-26-18(25)7-8-21-17(24)10-13-4-3-9-23(12-13)19-22-15-6-5-14(20)11-16(15)27-19/h5-6,11,13H,2-4,7-10,12H2,1H3,(H,21,24) |
| InChIKey | VDCIRRCUQQRGQP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate?
The IUPAC name of ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate (CID 154563768) is ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate.
What is the SMILES notation for ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate?
The canonical SMILES for ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate is CCOC(=O)CCNC(=O)CC1CCCN(c2nc3ccc(Cl)cc3o2)C1.
What is the InChIKey of ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate?
The InChIKey is VDCIRRCUQQRGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24ClN3O4/c1-2-26-18(25)7-8-21-17(24)10-13-4-3-9-23(12-13)19-22-15-6-5-14(20)11-16(15)27-19/h5-6,11,13H,2-4,7-10,12H2,1H3,(H,21,24).
What are the key properties of ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate?
ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate has a molecular weight of 393.87 g/mol, XLogP of 3.16, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]propanoate is sourced from PubChem (CID 154563768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).