C19H24ClN3O4 — CID 155493792
methyl 4-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]butanoate (PubChem CID 155493792) has the molecular formula C19H24ClN3O4 and a molecular weight of 393.87 g/mol. Its IUPAC name is methyl 4-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 155493792 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | methyl 4-[[2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CC1CCCN(c2nc3ccc(Cl)cc3o2)C1 |
| InChI | InChI=1S/C19H24ClN3O4/c1-26-18(25)5-2-8-21-17(24)10-13-4-3-9-23(12-13)19-22-15-7-6-14(20)11-16(15)27-19/h6-7,11,13H,2-5,8-10,12H2,1H3,(H,21,24) |
| InChIKey | QCIJQRZTEDJQJJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|