About 2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide
2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide (PubChem CID 154568516) has the molecular formula C20H28ClN3O3
and a molecular weight of 393.92 g/mol. Its IUPAC name is 2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide.
Molecular Properties
| Compound Name | 2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide |
| PubChem CID | 154568516 |
| Molecular Formula | C20H28ClN3O3 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide |
| SMILES | CCCOCCCNC(=O)CC1CCCN(c2nc3ccc(Cl)cc3o2)C1 |
| InChI | InChI=1S/C20H28ClN3O3/c1-2-10-26-11-4-8-22-19(25)12-15-5-3-9-24(14-15)20-23-17-7-6-16(21)13-18(17)27-20/h6-7,13,15H,2-5,8-12,14H2,1H3,(H,22,25) |
| InChIKey | INTMLTVSPKBNBW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide?
The IUPAC name of 2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide (CID 154568516) is 2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide.
What is the SMILES notation for 2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide?
The canonical SMILES for 2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide is CCCOCCCNC(=O)CC1CCCN(c2nc3ccc(Cl)cc3o2)C1.
What is the InChIKey of 2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide?
The InChIKey is INTMLTVSPKBNBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28ClN3O3/c1-2-10-26-11-4-8-22-19(25)12-15-5-3-9-24(14-15)20-23-17-7-6-16(21)13-18(17)27-20/h6-7,13,15H,2-5,8-12,14H2,1H3,(H,22,25).
What are the key properties of 2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide?
2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide has a molecular weight of 393.92 g/mol, XLogP of 4.02, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]-N-(3-propoxypropyl)acetamide is sourced from PubChem (CID 154568516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).