C17H25N5O — CID 154564940
6-methyl-4-[4-(2-propoxyethyl)piperazin-1-yl]pyrido[3,2-d]pyrimidine (PubChem CID 154564940) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 6-methyl-4-[4-(2-propoxyethyl)piperazin-1-yl]pyrido[3,2-d]pyrimidine.
| Compound Name | 6-methyl-4-[4-(2-propoxyethyl)piperazin-1-yl]pyrido[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 154564940 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 6-methyl-4-[4-(2-propoxyethyl)piperazin-1-yl]pyrido[3,2-d]pyrimidine |
| SMILES | CCCOCCN1CCN(c2ncnc3ccc(C)nc23)CC1 |
| InChI | InChI=1S/C17H25N5O/c1-3-11-23-12-10-21-6-8-22(9-7-21)17-16-15(18-13-19-17)5-4-14(2)20-16/h4-5,13H,3,6-12H2,1-2H3 |
| InChIKey | ARHGSNOEMIJAIY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|