C17H19N3O3S2 — CID 154568103
[(3S,3aS,6aR)-3-amino-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(2-benzyl-1,3-thiazol-4-yl)methanone (PubChem CID 154568103) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is [(3S,3aS,6aR)-3-amino-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(2-benzyl-1,3-thiazol-4-yl)methanone.
| Compound Name | [(3S,3aS,6aR)-3-amino-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(2-benzyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 154568103 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [(3S,3aS,6aR)-3-amino-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(2-benzyl-1,3-thiazol-4-yl)methanone |
| SMILES | N[C@@H]1CS(=O)(=O)[C@H]2CN(C(=O)c3csc(Cc4ccccc4)n3)C[C@@H]12 |
| InChI | InChI=1S/C17H19N3O3S2/c18-13-10-25(22,23)15-8-20(7-12(13)15)17(21)14-9-24-16(19-14)6-11-4-2-1-3-5-11/h1-5,9,12-13,15H,6-8,10,18H2/t12-,13+,15-/m0/s1 |
| InChIKey | OQYUEOGVPGXAQL-GUTXKFCHSA-N |
| XLogP | 0.93 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |