C19H23N3OS — CID 154860981
(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(2-benzyl-1,3-thiazol-4-yl)methanone (PubChem CID 154860981) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is (4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(2-benzyl-1,3-thiazol-4-yl)methanone.
| Compound Name | (4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(2-benzyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 154860981 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(2-benzyl-1,3-thiazol-4-yl)methanone |
| SMILES | NC1CCCC2CN(C(=O)c3csc(Cc4ccccc4)n3)CC12 |
| InChI | InChI=1S/C19H23N3OS/c20-16-8-4-7-14-10-22(11-15(14)16)19(23)17-12-24-18(21-17)9-13-5-2-1-3-6-13/h1-3,5-6,12,14-16H,4,7-11,20H2 |
| InChIKey | TVJVEZNFUCCJGG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |