C19H17N3OS — CID 70751823
(2-benzyl-1,3-thiazol-4-yl)-(3-pyridin-3-ylazetidin-1-yl)methanone (PubChem CID 70751823) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is (2-benzyl-1,3-thiazol-4-yl)-(3-pyridin-3-ylazetidin-1-yl)methanone.
| Compound Name | (2-benzyl-1,3-thiazol-4-yl)-(3-pyridin-3-ylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 70751823 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (2-benzyl-1,3-thiazol-4-yl)-(3-pyridin-3-ylazetidin-1-yl)methanone |
| SMILES | O=C(c1csc(Cc2ccccc2)n1)N1CC(c2cccnc2)C1 |
| InChI | InChI=1S/C19H17N3OS/c23-19(22-11-16(12-22)15-7-4-8-20-10-15)17-13-24-18(21-17)9-14-5-2-1-3-6-14/h1-8,10,13,16H,9,11-12H2 |
| InChIKey | SSOAGLADKQKTFS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |