C17H22N6 — CID 154568338
6-methyl-N-[3-(2-propan-2-ylimidazol-1-yl)propyl]pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 154568338) has the molecular formula C17H22N6 and a molecular weight of 310.41 g/mol. Its IUPAC name is 6-methyl-N-[3-(2-propan-2-ylimidazol-1-yl)propyl]pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-methyl-N-[3-(2-propan-2-ylimidazol-1-yl)propyl]pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 154568338 |
| Molecular Formula | C17H22N6 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 6-methyl-N-[3-(2-propan-2-ylimidazol-1-yl)propyl]pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1ccc2ncnc(NCCCn3ccnc3C(C)C)c2n1 |
| InChI | InChI=1S/C17H22N6/c1-12(2)17-19-8-10-23(17)9-4-7-18-16-15-14(20-11-21-16)6-5-13(3)22-15/h5-6,8,10-12H,4,7,9H2,1-3H3,(H,18,20,21) |
| InChIKey | VAYFUTLXBREZQH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|