C16H24Cl3N3 — CID 19429502
N-[(4-chlorophenyl)methyl]-3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrochloride (PubChem CID 19429502) has the molecular formula C16H24Cl3N3 and a molecular weight of 364.75 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrochloride.
| Compound Name | N-[(4-chlorophenyl)methyl]-3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 19429502 |
| Molecular Formula | C16H24Cl3N3 |
| Molecular Weight | 364.75 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrochloride |
| SMILES | CC(C)c1nccn1CCCNCc1ccc(Cl)cc1.Cl.Cl |
| InChI | InChI=1S/C16H22ClN3.2ClH/c1-13(2)16-19-9-11-20(16)10-3-8-18-12-14-4-6-15(17)7-5-14;;/h4-7,9,11,13,18H,3,8,10,12H2,1-2H3;2*1H |
| InChIKey | RGWAKWAGXRBCAC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.75 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|