C22H31N3O — CID 154570768
[(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-[(2R,5R)-5-phenylpyrrolidin-2-yl]methanone (PubChem CID 154570768) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is [(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-[(2R,5R)-5-phenylpyrrolidin-2-yl]methanone.
| Compound Name | [(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-[(2R,5R)-5-phenylpyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 154570768 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | [(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-[(2R,5R)-5-phenylpyrrolidin-2-yl]methanone |
| SMILES | O=C([C@H]1CC[C@H](c2ccccc2)N1)N1C[C@@H]2C[C@H](C1)[C@@H]1CCCCN1C2 |
| InChI | InChI=1S/C22H31N3O/c26-22(20-10-9-19(23-20)17-6-2-1-3-7-17)25-14-16-12-18(15-25)21-8-4-5-11-24(21)13-16/h1-3,6-7,16,18-21,23H,4-5,8-15H2/t16-,18-,19-,20-,21+/m1/s1 |
| InChIKey | MTCJNFJUKBDZFZ-MLZLACJZSA-N |
| XLogP | 2.81 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |