C19H27N3O3 — CID 154571372
ethyl (3aS,4S,5S,7aR)-5-methyl-2-(4-pyrazol-1-ylbutanoyl)-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate (PubChem CID 154571372) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is ethyl (3aS,4S,5S,7aR)-5-methyl-2-(4-pyrazol-1-ylbutanoyl)-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate.
| Compound Name | ethyl (3aS,4S,5S,7aR)-5-methyl-2-(4-pyrazol-1-ylbutanoyl)-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
|---|---|
| PubChem CID | 154571372 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | ethyl (3aS,4S,5S,7aR)-5-methyl-2-(4-pyrazol-1-ylbutanoyl)-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CN(C(=O)CCCn3cccn3)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C19H27N3O3/c1-3-25-19(24)18-14(2)7-8-15-12-21(13-16(15)18)17(23)6-4-10-22-11-5-9-20-22/h5,7-9,11,14-16,18H,3-4,6,10,12-13H2,1-2H3/t14-,15-,16-,18-/m0/s1 |
| InChIKey | JVLPSEBLFCPYJF-OVWQWFNUSA-N |
| XLogP | 2.12 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|