C12H19ClN2O — CID 154573872
2,6-dimethyl-3-piperidin-4-yloxypyridine;hydrochloride (PubChem CID 154573872) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 2,6-dimethyl-3-piperidin-4-yloxypyridine;hydrochloride.
| Compound Name | 2,6-dimethyl-3-piperidin-4-yloxypyridine;hydrochloride |
|---|---|
| PubChem CID | 154573872 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2,6-dimethyl-3-piperidin-4-yloxypyridine;hydrochloride |
| SMILES | Cc1ccc(OC2CCNCC2)c(C)n1.Cl |
| InChI | InChI=1S/C12H18N2O.ClH/c1-9-3-4-12(10(2)14-9)15-11-5-7-13-8-6-11;/h3-4,11,13H,5-8H2,1-2H3;1H |
| InChIKey | OZPWMGTXVOMMCF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |