C31H42N5O9P — CID 154573935
[4-[(2S)-2-acetamido-3-[[1-[[(2S)-4-amino-1,4-dioxo-1-(3-phenylpropylamino)butan-2-yl]carbamoyl]cyclohexyl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate (PubChem CID 154573935) has the molecular formula C31H42N5O9P and a molecular weight of 659.68 g/mol. Its IUPAC name is [4-[(2S)-2-acetamido-3-[[1-[[(2S)-4-amino-1,4-dioxo-1-(3-phenylpropylamino)butan-2-yl]carbamoyl]cyclohexyl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[(2S)-2-acetamido-3-[[1-[[(2S)-4-amino-1,4-dioxo-1-(3-phenylpropylamino)butan-2-yl]carbamoyl]cyclohexyl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 154573935 |
| Molecular Formula | C31H42N5O9P |
| Molecular Weight | 659.68 g/mol |
| Exact Mass | 659.27 |
| IUPAC Name | [4-[(2S)-2-acetamido-3-[[1-[[(2S)-4-amino-1,4-dioxo-1-(3-phenylpropylamino)butan-2-yl]carbamoyl]cyclohexyl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate |
| SMILES | CC(=O)N[C@@H](Cc1ccc(OP(=O)(O)O)cc1)C(=O)NC1(C(=O)N[C@@H](CC(N)=O)C(=O)NCCCc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C31H42N5O9P/c1-21(37)34-25(19-23-12-14-24(15-13-23)45-46(42,43)44)29(40)36-31(16-6-3-7-17-31)30(41)35-26(20-27(32)38)28(39)33-18-8-11-22-9-4-2-5-10-22/h2,4-5,9-10,12-15,25-26H,3,6-8,11,16-20H2,1H3,(H2,32,38)(H,33,39)(H,34,37)(H,35,41)(H,36,40)(H2,42,43,44)/t25-,26-/m0/s1 |
| InChIKey | RPTNCOWNZCOPDL-UIOOFZCWSA-N |
| XLogP | 1.13 |
| TPSA | 226.25 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.68 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|