C36H45N4O9P — CID 23314963
(3S)-4-[[1-[[(2S)-4-amino-1-(3-naphthalen-1-ylpropylamino)-1,4-dioxobutan-2-yl]carbamoyl]cyclohexyl]amino]-4-oxo-3-[[4-(phosphonomethyl)phenyl]methyl]butanoic acid (PubChem CID 23314963) has the molecular formula C36H45N4O9P and a molecular weight of 708.75 g/mol. Its IUPAC name is (3S)-4-[[1-[[(2S)-4-amino-1-(3-naphthalen-1-ylpropylamino)-1,4-dioxobutan-2-yl]carbamoyl]cyclohexyl]amino]-4-oxo-3-[[4-(phosphonomethyl)phenyl]methyl]butanoic acid.
| Compound Name | (3S)-4-[[1-[[(2S)-4-amino-1-(3-naphthalen-1-ylpropylamino)-1,4-dioxobutan-2-yl]carbamoyl]cyclohexyl]amino]-4-oxo-3-[[4-(phosphonomethyl)phenyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 23314963 |
| Molecular Formula | C36H45N4O9P |
| Molecular Weight | 708.75 g/mol |
| Exact Mass | 708.29 |
| IUPAC Name | (3S)-4-[[1-[[(2S)-4-amino-1-(3-naphthalen-1-ylpropylamino)-1,4-dioxobutan-2-yl]carbamoyl]cyclohexyl]amino]-4-oxo-3-[[4-(phosphonomethyl)phenyl]methyl]butanoic acid |
| SMILES | NC(=O)C[C@H](NC(=O)C1(NC(=O)[C@H](CC(=O)O)Cc2ccc(CP(=O)(O)O)cc2)CCCCC1)C(=O)NCCCc1cccc2ccccc12 |
| InChI | InChI=1S/C36H45N4O9P/c37-31(41)22-30(34(45)38-19-7-11-27-10-6-9-26-8-2-3-12-29(26)27)39-35(46)36(17-4-1-5-18-36)40-33(44)28(21-32(42)43)20-24-13-15-25(16-14-24)23-50(47,48)49/h2-3,6,8-10,12-16,28,30H,1,4-5,7,11,17-23H2,(H2,37,41)(H,38,45)(H,39,46)(H,40,44)(H,42,43)(H2,47,48,49)/t28-,30-/m0/s1 |
| InChIKey | AYRBFDFQLSQIBI-JDXGNMNLSA-N |
| XLogP | 3.08 |
| TPSA | 225.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.75 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|