C28H37N3O3 — CID 89243119
(2S)-2-[(1-methylcyclohexanecarbonyl)amino]-N-[(2S)-2-(naphthalen-1-ylmethyl)pent-4-enyl]butanediamide (PubChem CID 89243119) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is (2S)-2-[(1-methylcyclohexanecarbonyl)amino]-N-[(2S)-2-(naphthalen-1-ylmethyl)pent-4-enyl]butanediamide.
| Compound Name | (2S)-2-[(1-methylcyclohexanecarbonyl)amino]-N-[(2S)-2-(naphthalen-1-ylmethyl)pent-4-enyl]butanediamide |
|---|---|
| PubChem CID | 89243119 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | (2S)-2-[(1-methylcyclohexanecarbonyl)amino]-N-[(2S)-2-(naphthalen-1-ylmethyl)pent-4-enyl]butanediamide |
| SMILES | C=CC[C@H](CNC(=O)[C@H](CC(N)=O)NC(=O)C1(C)CCCCC1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C28H37N3O3/c1-3-10-20(17-22-13-9-12-21-11-5-6-14-23(21)22)19-30-26(33)24(18-25(29)32)31-27(34)28(2)15-7-4-8-16-28/h3,5-6,9,11-14,20,24H,1,4,7-8,10,15-19H2,2H3,(H2,29,32)(H,30,33)(H,31,34)/t20-,24-/m0/s1 |
| InChIKey | YMSAYVULKFZOQU-RDPSFJRHSA-N |
| XLogP | 4.02 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|