C20H25N3O2 — CID 11427767
(2S)-2-amino-N-[(2S)-2-(naphthalen-1-ylmethyl)pent-4-enyl]butanediamide (PubChem CID 11427767) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-2-(naphthalen-1-ylmethyl)pent-4-enyl]butanediamide.
| Compound Name | (2S)-2-amino-N-[(2S)-2-(naphthalen-1-ylmethyl)pent-4-enyl]butanediamide |
|---|---|
| PubChem CID | 11427767 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-2-(naphthalen-1-ylmethyl)pent-4-enyl]butanediamide |
| SMILES | C=CC[C@H](CNC(=O)[C@@H](N)CC(N)=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C20H25N3O2/c1-2-6-14(13-23-20(25)18(21)12-19(22)24)11-16-9-5-8-15-7-3-4-10-17(15)16/h2-5,7-10,14,18H,1,6,11-13,21H2,(H2,22,24)(H,23,25)/t14-,18-/m0/s1 |
| InChIKey | BHNONZMLUMLWEP-KSSFIOAISA-N |
| XLogP | 1.89 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|