C27H31N3O4S — CID 23625948
N-[1-[[(2R)-1-(3-hydroxypropylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]cyclopentyl]-1-benzothiophene-2-carboxamide (PubChem CID 23625948) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-[1-[[(2R)-1-(3-hydroxypropylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]cyclopentyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[1-[[(2R)-1-(3-hydroxypropylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]cyclopentyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 23625948 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | N-[1-[[(2R)-1-(3-hydroxypropylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]cyclopentyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC1(C(=O)N[C@H](Cc2ccccc2)C(=O)NCCCO)CCCC1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C27H31N3O4S/c31-16-8-15-28-24(32)21(17-19-9-2-1-3-10-19)29-26(34)27(13-6-7-14-27)30-25(33)23-18-20-11-4-5-12-22(20)35-23/h1-5,9-12,18,21,31H,6-8,13-17H2,(H,28,32)(H,29,34)(H,30,33)/t21-/m1/s1 |
| InChIKey | XPKBOOVQBLWWNZ-OAQYLSRUSA-N |
| XLogP | 3.17 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|