About benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate
benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate (PubChem CID 143504673) has the molecular formula C25H28N2O4S
and a molecular weight of 452.58 g/mol. Its IUPAC name is benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate.
Molecular Properties
| Compound Name | benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate |
| PubChem CID | 143504673 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)C1(NC(=O)c2cc3ccccc3s2)CCCCC1.c1ccccc1 |
| InChI | InChI=1S/C19H22N2O4S.C6H6/c1-25-16(22)12-20-18(24)19(9-5-2-6-10-19)21-17(23)15-11-13-7-3-4-8-14(13)26-15;1-2-4-6-5-3-1/h3-4,7-8,11H,2,5-6,9-10,12H2,1H3,(H,20,24)(H,21,23);1-6H |
| InChIKey | BSBAPJOKAJYZDL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate?
The IUPAC name of benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate (CID 143504673) is benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate.
What is the SMILES notation for benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate?
The canonical SMILES for benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate is COC(=O)CNC(=O)C1(NC(=O)c2cc3ccccc3s2)CCCCC1.c1ccccc1.
What is the InChIKey of benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate?
The InChIKey is BSBAPJOKAJYZDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O4S.C6H6/c1-25-16(22)12-20-18(24)19(9-5-2-6-10-19)21-17(23)15-11-13-7-3-4-8-14(13)26-15;1-2-4-6-5-3-1/h3-4,7-8,11H,2,5-6,9-10,12H2,1H3,(H,20,24)(H,21,23);1-6H.
What are the key properties of benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate?
benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate has a molecular weight of 452.58 g/mol, XLogP of 4.31, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;methyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate is sourced from PubChem (CID 143504673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).