C24H24N2O4S — CID 24738023
phenyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate (PubChem CID 24738023) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is phenyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate.
| Compound Name | phenyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate |
|---|---|
| PubChem CID | 24738023 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | phenyl 2-[[1-(1-benzothiophene-2-carbonylamino)cyclohexanecarbonyl]amino]acetate |
| SMILES | O=C(CNC(=O)C1(NC(=O)c2cc3ccccc3s2)CCCCC1)Oc1ccccc1 |
| InChI | InChI=1S/C24H24N2O4S/c27-21(30-18-10-3-1-4-11-18)16-25-23(29)24(13-7-2-8-14-24)26-22(28)20-15-17-9-5-6-12-19(17)31-20/h1,3-6,9-12,15H,2,7-8,13-14,16H2,(H,25,29)(H,26,28) |
| InChIKey | GORVFRKSALJEHT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|