C13H23Cl2N — CID 154573995
1-(chloromethyl)-4,6,6,7-tetramethyl-1-azoniabicyclo[3.3.1]non-3-ene chloride (PubChem CID 154573995) has the molecular formula C13H23Cl2N and a molecular weight of 264.24 g/mol. Its IUPAC name is 1-(chloromethyl)-4,6,6,7-tetramethyl-1-azoniabicyclo[3.3.1]non-3-ene chloride.
| Compound Name | 1-(chloromethyl)-4,6,6,7-tetramethyl-1-azoniabicyclo[3.3.1]non-3-ene chloride |
|---|---|
| PubChem CID | 154573995 |
| Molecular Formula | C13H23Cl2N |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1-(chloromethyl)-4,6,6,7-tetramethyl-1-azoniabicyclo[3.3.1]non-3-ene chloride |
| SMILES | CC1=CC[N+]2(CCl)CC(C)C(C)(C)C1C2.[Cl-] |
| InChI | InChI=1S/C13H23ClN.ClH/c1-10-5-6-15(9-14)7-11(2)13(3,4)12(10)8-15;/h5,11-12H,6-9H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | CBRPFABXBUMPBJ-UHFFFAOYSA-M |
| XLogP | 0.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|