3,5-diphenyltriazole-4-carboxylic acid;silver

C15H11AgN3O2 — CID 154574130

IUPAC3,5-diphenyltriazole-4-carboxylic acid;silver
SMILESO=C(O)c1c(-c2ccccc2)nnn1-c1ccccc1.[Ag]
InChIInChI=1S/C15H11N3O2.Ag/c19-15(20)14-13(11-7-3-1-4-8-11)16-17-18(14)12-9-5-2-6-10-12;/h1-10H,(H,19,20);
InChIKeyKIZKTSMVQIFRKF-UHFFFAOYSA-N
MW373.14 g/mol
LogP2.63
Rot. Bonds3

About 3,5-diphenyltriazole-4-carboxylic acid;silver

3,5-diphenyltriazole-4-carboxylic acid;silver (PubChem CID 154574130) has the molecular formula C15H11AgN3O2 and a molecular weight of 373.14 g/mol. Its IUPAC name is 3,5-diphenyltriazole-4-carboxylic acid;silver.

Molecular Properties

Compound Name3,5-diphenyltriazole-4-carboxylic acid;silver
PubChem CID154574130
Molecular FormulaC15H11AgN3O2
Molecular Weight373.14 g/mol
Exact Mass371.99
IUPAC Name3,5-diphenyltriazole-4-carboxylic acid;silver
SMILESO=C(O)c1c(-c2ccccc2)nnn1-c1ccccc1.[Ag]
InChIInChI=1S/C15H11N3O2.Ag/c19-15(20)14-13(11-7-3-1-4-8-11)16-17-18(14)12-9-5-2-6-10-12;/h1-10H,(H,19,20);
InChIKeyKIZKTSMVQIFRKF-UHFFFAOYSA-N
XLogP2.63
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500373.14
LogP ≤ 52.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3,5-diphenyltriazole-4-carboxylic acid;silver with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-diphenyltriazole-4-carboxylic acid;silver?
The IUPAC name of 3,5-diphenyltriazole-4-carboxylic acid;silver (CID 154574130) is 3,5-diphenyltriazole-4-carboxylic acid;silver.
What is the SMILES notation for 3,5-diphenyltriazole-4-carboxylic acid;silver?
The canonical SMILES for 3,5-diphenyltriazole-4-carboxylic acid;silver is O=C(O)c1c(-c2ccccc2)nnn1-c1ccccc1.[Ag].
What is the InChIKey of 3,5-diphenyltriazole-4-carboxylic acid;silver?
The InChIKey is KIZKTSMVQIFRKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O2.Ag/c19-15(20)14-13(11-7-3-1-4-8-11)16-17-18(14)12-9-5-2-6-10-12;/h1-10H,(H,19,20);.
What are the key properties of 3,5-diphenyltriazole-4-carboxylic acid;silver?
3,5-diphenyltriazole-4-carboxylic acid;silver has a molecular weight of 373.14 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diphenyltriazole-4-carboxylic acid;silver is sourced from PubChem (CID 154574130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).