C15H11AgN3O2 — CID 154574130
3,5-diphenyltriazole-4-carboxylic acid;silver (PubChem CID 154574130) has the molecular formula C15H11AgN3O2 and a molecular weight of 373.14 g/mol. Its IUPAC name is 3,5-diphenyltriazole-4-carboxylic acid;silver.
| Compound Name | 3,5-diphenyltriazole-4-carboxylic acid;silver |
|---|---|
| PubChem CID | 154574130 |
| Molecular Formula | C15H11AgN3O2 |
| Molecular Weight | 373.14 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 3,5-diphenyltriazole-4-carboxylic acid;silver |
| SMILES | O=C(O)c1c(-c2ccccc2)nnn1-c1ccccc1.[Ag] |
| InChI | InChI=1S/C15H11N3O2.Ag/c19-15(20)14-13(11-7-3-1-4-8-11)16-17-18(14)12-9-5-2-6-10-12;/h1-10H,(H,19,20); |
| InChIKey | KIZKTSMVQIFRKF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.14 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |