C22H15N3 — CID 135009100
1,4-diphenyl-5-(2-phenylethynyl)triazole (PubChem CID 135009100) has the molecular formula C22H15N3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1,4-diphenyl-5-(2-phenylethynyl)triazole.
| Compound Name | 1,4-diphenyl-5-(2-phenylethynyl)triazole |
|---|---|
| PubChem CID | 135009100 |
| Molecular Formula | C22H15N3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1,4-diphenyl-5-(2-phenylethynyl)triazole |
| SMILES | C(#Cc1c(-c2ccccc2)nnn1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H15N3/c1-4-10-18(11-5-1)16-17-21-22(19-12-6-2-7-13-19)23-24-25(21)20-14-8-3-9-15-20/h1-15H |
| InChIKey | DPYUVPBJZIPFOK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|