C18H16F3IO — CID 154574172
1-iodo-2-(3-methyl-1-phenylbut-3-enoxy)-4-(trifluoromethyl)benzene (PubChem CID 154574172) has the molecular formula C18H16F3IO and a molecular weight of 432.22 g/mol. Its IUPAC name is 1-iodo-2-(3-methyl-1-phenylbut-3-enoxy)-4-(trifluoromethyl)benzene.
| Compound Name | 1-iodo-2-(3-methyl-1-phenylbut-3-enoxy)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 154574172 |
| Molecular Formula | C18H16F3IO |
| Molecular Weight | 432.22 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 1-iodo-2-(3-methyl-1-phenylbut-3-enoxy)-4-(trifluoromethyl)benzene |
| SMILES | C=C(C)CC(Oc1cc(C(F)(F)F)ccc1I)c1ccccc1 |
| InChI | InChI=1S/C18H16F3IO/c1-12(2)10-16(13-6-4-3-5-7-13)23-17-11-14(18(19,20)21)8-9-15(17)22/h3-9,11,16H,1,10H2,2H3 |
| InChIKey | BRNDYFHGGHBWSX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.22 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|