C10H18FNO3 — CID 154575288
tert-butyl (3R,5S)-3-fluoro-5-hydroxypiperidine-1-carboxylate (PubChem CID 154575288) has the molecular formula C10H18FNO3 and a molecular weight of 219.26 g/mol. Its IUPAC name is tert-butyl (3R,5S)-3-fluoro-5-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,5S)-3-fluoro-5-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 154575288 |
| Molecular Formula | C10H18FNO3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | tert-butyl (3R,5S)-3-fluoro-5-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O)C[C@@H](F)C1 |
| InChI | InChI=1S/C10H18FNO3/c1-10(2,3)15-9(14)12-5-7(11)4-8(13)6-12/h7-8,13H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | WINOHIISMKZAHH-SFYZADRCSA-N |
| XLogP | 1.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |