About 5-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride
5-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride (PubChem CID 154577322) has the molecular formula C7H9ClN4
and a molecular weight of 184.63 g/mol. Its IUPAC name is 5-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride.
Analyze 5-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride?
The IUPAC name of 5-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride (CID 154577322) is 5-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride.
What is the SMILES notation for 5-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride?
The canonical SMILES for 5-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride is Cc1ccn2ncc(N)c2n1.Cl.
What is the InChIKey of 5-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride?
The InChIKey is WLRVPCIMSLXVEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4.ClH/c1-5-2-3-11-7(10-5)6(8)4-9-11;/h2-4H,8H2,1H3;1H.
What are the key properties of 5-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride?
5-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride has a molecular weight of 184.63 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride is sourced from PubChem (CID 154577322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).