C18H26N4O5S — CID 154579302
2-cyclohexyl-8-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione (PubChem CID 154579302) has the molecular formula C18H26N4O5S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-cyclohexyl-8-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione.
| Compound Name | 2-cyclohexyl-8-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione |
|---|---|
| PubChem CID | 154579302 |
| Molecular Formula | C18H26N4O5S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-cyclohexyl-8-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCCN2C(=O)N(C3CCCCC3)C(=O)C2C1 |
| InChI | InChI=1S/C18H26N4O5S/c1-12-16(13(2)27-19-12)28(25,26)20-9-6-10-21-15(11-20)17(23)22(18(21)24)14-7-4-3-5-8-14/h14-15H,3-11H2,1-2H3 |
| InChIKey | OQYFKMDHXPHYPA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|