C23H28N4O3 — CID 154579743
(3aR,5S,6aR)-2-benzyl-5-[(6-methoxypyridine-3-carbonyl)amino]-N-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide (PubChem CID 154579743) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is (3aR,5S,6aR)-2-benzyl-5-[(6-methoxypyridine-3-carbonyl)amino]-N-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,5S,6aR)-2-benzyl-5-[(6-methoxypyridine-3-carbonyl)amino]-N-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 154579743 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (3aR,5S,6aR)-2-benzyl-5-[(6-methoxypyridine-3-carbonyl)amino]-N-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide |
| SMILES | CNC(=O)[C@]12C[C@@H](NC(=O)c3ccc(OC)nc3)C[C@H]1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C23H28N4O3/c1-24-22(29)23-11-19(26-21(28)17-8-9-20(30-2)25-12-17)10-18(23)14-27(15-23)13-16-6-4-3-5-7-16/h3-9,12,18-19H,10-11,13-15H2,1-2H3,(H,24,29)(H,26,28)/t18-,19-,23-/m0/s1 |
| InChIKey | PPKGAHMFADKFNJ-YDHSSHFGSA-N |
| XLogP | 1.85 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |