C24H31N3O3S — CID 171150384
2-benzyl-5-[(2-ethylphenyl)sulfonylamino]-N-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide (PubChem CID 171150384) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is 2-benzyl-5-[(2-ethylphenyl)sulfonylamino]-N-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide.
| Compound Name | 2-benzyl-5-[(2-ethylphenyl)sulfonylamino]-N-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 171150384 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 2-benzyl-5-[(2-ethylphenyl)sulfonylamino]-N-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide |
| SMILES | CCc1ccccc1S(=O)(=O)NC1CC2CN(Cc3ccccc3)CC2(C(=O)NC)C1 |
| InChI | InChI=1S/C24H31N3O3S/c1-3-19-11-7-8-12-22(19)31(29,30)26-21-13-20-16-27(15-18-9-5-4-6-10-18)17-24(20,14-21)23(28)25-2/h4-12,20-21,26H,3,13-17H2,1-2H3,(H,25,28) |
| InChIKey | XGUPSIZYTJEBLN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |