C20H25N5O — CID 125231546
(4aR,7aR)-6-benzyl-N-methyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide (PubChem CID 125231546) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is (4aR,7aR)-6-benzyl-N-methyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide.
| Compound Name | (4aR,7aR)-6-benzyl-N-methyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide |
|---|---|
| PubChem CID | 125231546 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | (4aR,7aR)-6-benzyl-N-methyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide |
| SMILES | CNC(=O)[C@@]12CCCN(c3ncccn3)[C@H]1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C20H25N5O/c1-21-18(26)20-9-5-12-25(19-22-10-6-11-23-19)17(20)14-24(15-20)13-16-7-3-2-4-8-16/h2-4,6-8,10-11,17H,5,9,12-15H2,1H3,(H,21,26)/t17-,20+/m0/s1 |
| InChIKey | VQZRGJUTVIATNR-FXAWDEMLSA-N |
| XLogP | 1.69 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |