C16H25N5O — CID 124807369
(4aS,7aR)-6-ethyl-N,N-dimethyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide (PubChem CID 124807369) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is (4aS,7aR)-6-ethyl-N,N-dimethyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide.
| Compound Name | (4aS,7aR)-6-ethyl-N,N-dimethyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide |
|---|---|
| PubChem CID | 124807369 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | (4aS,7aR)-6-ethyl-N,N-dimethyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide |
| SMILES | CCN1C[C@@H]2N(c3ncccn3)CCC[C@]2(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C16H25N5O/c1-4-20-11-13-16(12-20,14(22)19(2)3)7-5-10-21(13)15-17-8-6-9-18-15/h6,8-9,13H,4-5,7,10-12H2,1-3H3/t13-,16-/m0/s1 |
| InChIKey | OXZZOPSYKTZTHA-BBRMVZONSA-N |
| XLogP | 0.86 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |