C24H30F3N5O3 — CID 155834400
(4aR,7aS)-N,N-dimethyl-6-[(2-methylphenyl)methyl]-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155834400) has the molecular formula C24H30F3N5O3 and a molecular weight of 493.53 g/mol. Its IUPAC name is (4aR,7aS)-N,N-dimethyl-6-[(2-methylphenyl)methyl]-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (4aR,7aS)-N,N-dimethyl-6-[(2-methylphenyl)methyl]-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155834400 |
| Molecular Formula | C24H30F3N5O3 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | (4aR,7aS)-N,N-dimethyl-6-[(2-methylphenyl)methyl]-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccccc1CN1C[C@H]2N(c3ncccn3)CCC[C@@]2(C(=O)N(C)C)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H29N5O.C2HF3O2/c1-17-8-4-5-9-18(17)14-26-15-19-22(16-26,20(28)25(2)3)10-6-13-27(19)21-23-11-7-12-24-21;3-2(4,5)1(6)7/h4-5,7-9,11-12,19H,6,10,13-16H2,1-3H3;(H,6,7)/t19-,22-;/m1./s1 |
| InChIKey | QDNIOQVEFCYKKV-JENXBZAWSA-N |
| XLogP | 2.98 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |