C20H24N4O2S — CID 155881482
N-[(3aR,5S,6aR)-2-benzyl-3a-(methylcarbamoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-1,3-thiazole-4-carboxamide (PubChem CID 155881482) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[(3aR,5S,6aR)-2-benzyl-3a-(methylcarbamoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(3aR,5S,6aR)-2-benzyl-3a-(methylcarbamoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 155881482 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[(3aR,5S,6aR)-2-benzyl-3a-(methylcarbamoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)[C@]12C[C@@H](NC(=O)c3cscn3)C[C@H]1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C20H24N4O2S/c1-21-19(26)20-8-16(23-18(25)17-11-27-13-22-17)7-15(20)10-24(12-20)9-14-5-3-2-4-6-14/h2-6,11,13,15-16H,7-10,12H2,1H3,(H,21,26)(H,23,25)/t15-,16-,20-/m0/s1 |
| InChIKey | LYSZVVOUJRNDEK-FTRWYGJKSA-N |
| XLogP | 1.90 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |