About N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide
N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide (PubChem CID 98897312) has the molecular formula C18H22N4OS
and a molecular weight of 342.47 g/mol. Its IUPAC name is N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide |
| PubChem CID | 98897312 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cccnc1CN1CCC2(CC(NC(=O)c3cscn3)C2)C1 |
| InChI | InChI=1S/C18H22N4OS/c1-13-3-2-5-19-15(13)9-22-6-4-18(11-22)7-14(8-18)21-17(23)16-10-24-12-20-16/h2-3,5,10,12,14H,4,6-9,11H2,1H3,(H,21,23) |
| InChIKey | WATWTNJSQPHBRH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide?
The IUPAC name of N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide (CID 98897312) is N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide is Cc1cccnc1CN1CCC2(CC(NC(=O)c3cscn3)C2)C1.
What is the InChIKey of N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide?
The InChIKey is WATWTNJSQPHBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4OS/c1-13-3-2-5-19-15(13)9-22-6-4-18(11-22)7-14(8-18)21-17(23)16-10-24-12-20-16/h2-3,5,10,12,14H,4,6-9,11H2,1H3,(H,21,23).
What are the key properties of N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide?
N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide has a molecular weight of 342.47 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-[(3-methyl-2-pyridinyl)methyl]-6-azaspiro[3.4]octan-2-yl]-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 98897312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).