C12H13F3N4S — CID 154580579
2-methylsulfanyl-4-[4-(trifluoromethyl)piperidin-1-yl]pyrimidine-5-carbonitrile (PubChem CID 154580579) has the molecular formula C12H13F3N4S and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-methylsulfanyl-4-[4-(trifluoromethyl)piperidin-1-yl]pyrimidine-5-carbonitrile.
| Compound Name | 2-methylsulfanyl-4-[4-(trifluoromethyl)piperidin-1-yl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 154580579 |
| Molecular Formula | C12H13F3N4S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-methylsulfanyl-4-[4-(trifluoromethyl)piperidin-1-yl]pyrimidine-5-carbonitrile |
| SMILES | CSc1ncc(C#N)c(N2CCC(C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C12H13F3N4S/c1-20-11-17-7-8(6-16)10(18-11)19-4-2-9(3-5-19)12(13,14)15/h7,9H,2-5H2,1H3 |
| InChIKey | XVTRDJWJSUZEII-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |