C16H24N4O2S — CID 154582564
N-[[1-(6-cyclobutylpyrimidin-4-yl)azetidin-3-yl]methyl]-N-methylcyclopropanesulfonamide (PubChem CID 154582564) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[[1-(6-cyclobutylpyrimidin-4-yl)azetidin-3-yl]methyl]-N-methylcyclopropanesulfonamide.
| Compound Name | N-[[1-(6-cyclobutylpyrimidin-4-yl)azetidin-3-yl]methyl]-N-methylcyclopropanesulfonamide |
|---|---|
| PubChem CID | 154582564 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[[1-(6-cyclobutylpyrimidin-4-yl)azetidin-3-yl]methyl]-N-methylcyclopropanesulfonamide |
| SMILES | CN(CC1CN(c2cc(C3CCC3)ncn2)C1)S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C16H24N4O2S/c1-19(23(21,22)14-5-6-14)8-12-9-20(10-12)16-7-15(17-11-18-16)13-3-2-4-13/h7,11-14H,2-6,8-10H2,1H3 |
| InChIKey | ZJUUCCHYJUSHGJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |