C24H37N5O2 — CID 154584623
8-[[4-[5-(methoxymethyl)-2-pyridinyl]piperazin-1-yl]methyl]-2,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-5-one (PubChem CID 154584623) has the molecular formula C24H37N5O2 and a molecular weight of 427.59 g/mol. Its IUPAC name is 8-[[4-[5-(methoxymethyl)-2-pyridinyl]piperazin-1-yl]methyl]-2,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-5-one.
| Compound Name | 8-[[4-[5-(methoxymethyl)-2-pyridinyl]piperazin-1-yl]methyl]-2,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-5-one |
|---|---|
| PubChem CID | 154584623 |
| Molecular Formula | C24H37N5O2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | 8-[[4-[5-(methoxymethyl)-2-pyridinyl]piperazin-1-yl]methyl]-2,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-5-one |
| SMILES | COCc1ccc(N2CCN(CC3CCC4C(C3)NC(=O)C3CCCNC34)CC2)nc1 |
| InChI | InChI=1S/C24H37N5O2/c1-31-16-18-5-7-22(26-14-18)29-11-9-28(10-12-29)15-17-4-6-19-21(13-17)27-24(30)20-3-2-8-25-23(19)20/h5,7,14,17,19-21,23,25H,2-4,6,8-13,15-16H2,1H3,(H,27,30) |
| InChIKey | NSHLVFWVZFGSSQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |