C16H20N2O3S — CID 154584822
N-[(4-tert-butylphenyl)methyl]-1-oxidopyridin-1-ium-3-sulfonamide (PubChem CID 154584822) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-1-oxidopyridin-1-ium-3-sulfonamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-1-oxidopyridin-1-ium-3-sulfonamide |
|---|---|
| PubChem CID | 154584822 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-1-oxidopyridin-1-ium-3-sulfonamide |
| SMILES | CC(C)(C)c1ccc(CNS(=O)(=O)c2ccc[n+]([O-])c2)cc1 |
| InChI | InChI=1S/C16H20N2O3S/c1-16(2,3)14-8-6-13(7-9-14)11-17-22(20,21)15-5-4-10-18(19)12-15/h4-10,12,17H,11H2,1-3H3 |
| InChIKey | LUINAOSUESJCAY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|