C23H24ClN3O3S — CID 50913581
4-[[(4-tert-butylphenyl)sulfonylamino]methyl]-N-(5-chloro-3-pyridinyl)benzamide (PubChem CID 50913581) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is 4-[[(4-tert-butylphenyl)sulfonylamino]methyl]-N-(5-chloro-3-pyridinyl)benzamide.
| Compound Name | 4-[[(4-tert-butylphenyl)sulfonylamino]methyl]-N-(5-chloro-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 50913581 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 4-[[(4-tert-butylphenyl)sulfonylamino]methyl]-N-(5-chloro-3-pyridinyl)benzamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCc2ccc(C(=O)Nc3cncc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C23H24ClN3O3S/c1-23(2,3)18-8-10-21(11-9-18)31(29,30)26-13-16-4-6-17(7-5-16)22(28)27-20-12-19(24)14-25-15-20/h4-12,14-15,26H,13H2,1-3H3,(H,27,28) |
| InChIKey | CQUJKLYZGYMJAI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |