C15H29O6P2S+ — CID 154585765
phosphonooxy-[(6Z)-3,7,11-trimethyldodeca-6,10-dienyl]sulfanylphosphinic acid (PubChem CID 154585765) has the molecular formula C15H29O6P2S+ and a molecular weight of 399.41 g/mol. Its IUPAC name is phosphonooxy-[(6Z)-3,7,11-trimethyldodeca-6,10-dienyl]sulfanylphosphinic acid.
| Compound Name | phosphonooxy-[(6Z)-3,7,11-trimethyldodeca-6,10-dienyl]sulfanylphosphinic acid |
|---|---|
| PubChem CID | 154585765 |
| Molecular Formula | C15H29O6P2S+ |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | phosphonooxy-[(6Z)-3,7,11-trimethyldodeca-6,10-dienyl]sulfanylphosphinic acid |
| SMILES | CC(C)=CCC/C(C)=C\CCC(C)C[CH+]SP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C15H28O6P2S/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-24-23(19,20)21-22(16,17)18/h7,9,12,15H,5-6,8,10-11H2,1-4H3,(H2-,16,17,18,19,20)/p+1/b14-9- |
| InChIKey | DHHHPNKIISWFSN-ZROIWOOFSA-O |
| XLogP | 5.59 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|