C20H36O6P2S — CID 163410076
phosphonooxy-[(2E,6Z,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylphosphinic acid (PubChem CID 163410076) has the molecular formula C20H36O6P2S and a molecular weight of 466.52 g/mol. Its IUPAC name is phosphonooxy-[(2E,6Z,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylphosphinic acid.
| Compound Name | phosphonooxy-[(2E,6Z,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylphosphinic acid |
|---|---|
| PubChem CID | 163410076 |
| Molecular Formula | C20H36O6P2S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | phosphonooxy-[(2E,6Z,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylphosphinic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C\CC/C(C)=C/CSP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C20H36O6P2S/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-29-28(24,25)26-27(21,22)23/h9,11,13,15H,6-8,10,12,14,16H2,1-5H3,(H,24,25)(H2,21,22,23)/b18-11+,19-13-,20-15+ |
| InChIKey | BUSOKXFDTDWPOS-GJCDQOAASA-N |
| XLogP | 7.07 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|